MK-4256 [CAS 1104599-69-0]
Partner: MedChemexpress LLC
| CAS No: | 1104599-69-0 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 494.52 |
| Formula: | C27H23FN8O |
| SMILES: | CN1N=CC([C@@]2(C3=NOC(C)=N3)N[C@@H](C4=NC=C(C5=CC=C(F)C=C5)N4)CC6=C2NC7=C6C=CC=C7)=C1 |
| Purity: | 98.01 |
| Description: | MK-4256 is a potent and selective SSTR3 antagonist with IC50s of 0.66 nM and 0.36 nM in human and mouse receptor binding assays, respectively. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
