Oseltamivir acid [CAS 187227-45-8] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 187227-45-8 |
| Applications: | COVID-19-anti-virus |
| MW: | 284.35 |
| Formula: | C14H24N2O4 |
| SMILES: | O=C(O)C1=C[C@H]([C@@H]([C@H](C1)N)NC(C)=O)OC(CC)CC |
| Purity: | 99.54 |
| Description: | Oseltamivir acid (GS 4071), the active metabolite of Oseltamivir phosphate, is an orally bioavailable, potent and selective inhibitor of influenza virus neuraminidase (IC50=2 nM) with activity against both influenza A and B viruses[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
