PYZD-4409 [CAS 423148-78-1]
Partner: MedChemexpress LLC
| CAS No: | 423148-78-1 |
| Applications: | Cancer-Kinase/protease |
| MW: | 351.67 |
| Formula: | C14H7ClFN3O5 |
| SMILES: | FC1=CC=C(N2C(/C(C(N2)=O)=C\C3=CC=C([N+]([O-])=O)O3)=O)C=C1Cl |
| Purity: | 98.0 |
| Description: | PYZD-4409 is a specific inhibitor of the ubiquitin-activating enzyme UBA1 with an IC50 of 20 ?M (cell-free enzymatic assay). PYZD-4409 induces cell death in malignant cells and preferentially inhibits the clonogenic growth of primary acute myeloid leukemia cells[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
