7-Aminomethyl-10-methyl-11-fluoro camptothecin [CAS 2378616-23-8]
Partner: MedChemexpress LLC
| CAS No: | 2378616-23-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 409.41 |
| Formula: | C22H20FN3O4 |
| SMILES: | NCC1=C2C(C(N3C2)=CC([C@]4(CC)O)=C(C3=O)COC4=O)=NC5=CC(F)=C(C=C51)C |
| Purity: | 99.30 |
| Description: | 7-Aminomethyl-10-methyl-11-fluoro camptothecin is a cytotoxin of MC-AAA-NHCH2OCH2COO-7-aminomethyl-10-methyl-11-fluoro camptothecin (HY-132158). 7-Aminomethyl-10-methyl-11-fluoro camptothecin can be used for the synthesis of camptothecin antibody-drug conjugate (ADC)[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
