TRPV3 antagonist 74a [CAS 1432051-63-2]
Partner: MedChemexpress LLC
| CAS No: | 1432051-63-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 338.32 |
| Formula: | C17H17F3N2O2 |
| SMILES: | O[C@H](C1=CC=CC=N1)[C@@]2(C3=CC(C(F)(F)F)=CC=N3)C[C@@](O)(C2)C |
| Purity: | 98.0 |
| Description: | TRPV3 antagonist 74a is a potent and selective TRPV3 antagonist. TRPV3 antagonist 74a displays no significant activity against a panel of other ion channels. TRPV3 antagonist 74a can be used for the research of neuropathic pain[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
