DOTA-tris(tBu)ester NHS ester [CAS 819869-77-7]
Partner: MedChemexpress LLC
| CAS No: | 819869-77-7 |
| Applications: | Cancer-programmed cell death |
| MW: | 669.81 |
| Formula: | C32H55N5O10 |
| SMILES: | O=C(ON1C(CCC1=O)=O)CN2CCN(CC(OC(C)(C)C)=O)CCN(CC(OC(C)(C)C)=O)CCN(CC(OC(C)(C)C)=O)CC2 |
| Purity: | 98.0 |
| Description: | DOTA-tris(tBu)ester NHS ester is a derivative of DOTA for the labeling of peptides and antibodies[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
