BCN-PEG3-Biotin [CAS 1263166-92-2]
Partner: MedChemexpress LLC
| CAS No: | 1263166-92-2 |
| Applications: | Cancer-programmed cell death |
| MW: | 594.76 |
| Formula: | C29H46N4O7S |
| SMILES: | [H][C@@]12[C@@](CCC#CCC2)([H])[C@@H]1COC(NCCOCCOCCOCCNC(CCCC[C@@H]3SC[C@H](N4)[C@@H]3NC4=O)=O)=O |
| Purity: | 95.0 |
| Description: | BCN-PEG3-Biotin is a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. BCN-PEG3-Biotin is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
