N-(Amino-PEG5)-N-bis(PEG4-acid) [CAS 2093152-86-2]
Partner: MedChemexpress LLC
| CAS No: | 2093152-86-2 |
| Applications: | Cancer-programmed cell death |
| MW: | 776.91 |
| Formula: | C34H68N2O17 |
| SMILES: | O=C(O)CCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCN)CCOCCOCCOCCOCCC(O)=O |
| Purity: | 98.0 |
| Description: | N-(Amino-PEG5)-N-bis(PEG4-acid) is a PEG-based PROTAC linker used in the synthesis of PROTACs. N-(Amino-PEG5)-N-bis(PEG4-acid) contains an amino group with two terminal carboxylic acids[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
