(R)-(-)-JQ1 Enantiomer [CAS 1268524-71-5]
Partner: MedChemexpress LLC
| CAS No: | 1268524-71-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 456.99 |
| Formula: | C23H25ClN4O2S |
| SMILES: | O=C(C[C@H]1N=C(C2=C(N3C1=NN=C3C)SC(C)=C2C)C4=CC=C(C=C4)Cl)OC(C)(C)C |
| Purity: | 99.66 |
| Description: | (R)-(-)-JQ1 Enantiomer is the stereoisomer of (+)-JQ1. (+)-JQ1 potently decreases expression of both BRD4 target genes, whereas (R)-(-)-JQ1 Enantiomer has no effect. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
