PHA 568487 (free base) [CAS 527680-56-4]
Partner: MedChemexpress LLC
| CAS No: | 527680-56-4 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 288.34 |
| Formula: | C16H20N2O3 |
| SMILES: | O=C(C1=CC=C2C(OCCO2)=C1)N[C@@H]3C(CC4)CCN4C3 |
| Purity: | 99.52 |
| Description: | PHA 568487 free base is a selective alpha 7 nicotinic acetylcholine receptor (?-7 nAchR) agonist. PHA 568487 free base reduces neuroinflammation[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
