(S)-Seco-Duocarmycin SA [CAS 152785-82-5]
Partner: MedChemexpress LLC
| CAS No: | 152785-82-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 513.93 |
| Formula: | C25H24ClN3O7 |
| SMILES: | ClC[C@H]1C2=C(C=C(O)C3=C2C=C(C(OC)=O)N3)N(C(C4=CC5=CC(OC)=C(OC)C(OC)=C5N4)=O)C1 |
| Purity: | 99.0 |
| Description: | (S)-Seco-Duocarmycin SA is a DNA alkylator, cytotoxic to cancer cells, and acts as a ADC cytotoxin for antibody-drug conjugates[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
