N-Glycolylneuraminic acid [CAS 1113-83-3] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1113-83-3 |
| Applications: | COVID-19-anti-virus |
| MW: | 325.27 |
| Formula: | C11H19NO10 |
| SMILES: | O[C@@]1(O[C@H]([C@@H]([C@H](C1)O)NC(CO)=O)[C@@H]([C@@H](CO)O)O)C(O)=O |
| Purity: | 99.90 |
| Description: | N-Glycolylneuraminic acid is a nonhuman sialic acid molecule synthesized in pigs but not in humans. N-Glycolylneuraminic acid works as a decoy receptor of N-Glycolylneuraminic acid-binding influenza A viruses (IAVs)[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
