4'-Methoxychalcone [CAS 959-23-9]
Partner: MedChemexpress LLC
| CAS No: | 959-23-9 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 238.28 |
| Formula: | C16H14O2 |
| SMILES: | O=C(C1=CC=C(OC)C=C1)/C=C/C2=CC=CC=C2 |
| Purity: | 99.44 |
| Description: | 4'-Methoxychalcone regulates adipocyte differentiation through PPAR? activation. 4'-Methoxychalcone modulates the expression and secretion of various adipokines in adipose tissue that are involved in insulin sensitivity[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
