Vps34-PIK-III [CAS 1383716-40-2]
Partner: MedChemexpress LLC
| CAS No: | 1383716-40-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 319.36 |
| Formula: | C17H17N7 |
| SMILES: | NC1=NC=C(C2=CC=NC(NC3=CC=NC=C3)=N2)C(CC4CC4)=N1 |
| Purity: | 99.02 |
| Description: | Vps34-PIK-III is an orally active and selective VPS34 inhibitor (IC50=18 nM). Vps34-PIK-III effectively inhibits autophagy and can be used as a molecular tool. vps34-PIK-III is also a PI3K inhibitor that inhibits the expression of genes in liver cancer stem cells (CSCs)[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
