Mu ramyl dipeptide [CAS 53678-77-6]
Partner: MedChemexpress LLC
| CAS No: | 53678-77-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 492.48 |
| Formula: | C19H32N4O11 |
| SMILES: | CC(N[C@@H](C=O)[C@H]([C@H](O)[C@H](O)CO)O[C@H](C)C(N[C@@H](C)C(N[C@@H](C(N)=O)CCC(O)=O)=O)=O)=O |
| Purity: | 98.0 |
| Description: | Muramyl dipeptide (MDP) is a synthetic immunoreactive peptide, consisting of N-acetyl muramic acid attached to a short amino acid chain of L-Ala-D-isoGln. Muramyl dipeptide is an inducer of bone formation through induction of Runx2. Muramyl dipeptide directly enhances osteoblast differentiation by up-regulating Runx2 gene expression through MAPK pathways. Muramyl dipeptide is a NLRP1 agonist[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
