Fluorescein-DBCO [CAS 2054339-00-1]
Partner: MedChemexpress LLC
| CAS No: | 2054339-00-1 |
| Applications: | Cancer-programmed cell death |
| MW: | 665.71 |
| Formula: | C39H27N3O6S |
| SMILES: | O=C(N1CC2=C(C#CC3=C1C=CC=C3)C=CC=C2)CCNC(NC4=CC=C(C5=C4)C6(OC5=O)C7=C(OC8=C6C=CC(O)=C8)C=C(O)C=C7)=S |
| Purity: | 96.0 |
| Description: | Fluorescein-DBCO is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Fluorescein-DBCO is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
