N3-C2-NHS ester [CAS 850180-76-6]
Partner: MedChemexpress LLC
| CAS No: | 850180-76-6 |
| Applications: | Cancer-programmed cell death |
| MW: | 212.16 |
| Formula: | C7H8N4O4 |
| SMILES: | O=C(ON1C(CCC1=O)=O)CCN=[N+]=[N-] |
| Purity: | 98.0 |
| Description: | N3-C2-NHS ester is a noncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). N3-C2-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
