Biotinyl tyramide [CAS 41994-02-9]
Partner: MedChemexpress LLC
| CAS No: | 41994-02-9 |
| MW: | 363.47 |
| Formula: | C18H25N3O3S |
| SMILES: | O=C(NCCC1=CC=C(O)C=C1)CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O |
| Purity: | 99.73 |
| Description: | Biotinyl tyramide is a biotin derivative used for tyramide signal amplification (TSA), as a reagent to amplify both immunohistochemical signals and in situ hybridization protocols. Biotinyl tyramide can be used for the research of tyramide signal amplification[1][2][3][4][5]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
