Terlipressin (diacetate) [CAS 1884420-36-3]
Partner: MedChemexpress LLC
| CAS No: | 1884420-36-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 1347.48 |
| Formula: | C56H82N16O19S2 |
| SMILES: | O=C([C@H](CSSC[C@@H](C(N[C@H](C1=O)CC2=CC=C(O)C=C2)=O)NC(CNC(CNC(CN)=O)=O)=O)NC([C@@H](NC([C@@H](NC([C@](N1)([H])CC3=CC=CC=C3)=O)CCC(N)=O)=O)CC(N)=O)=O)N(CCC4)[C@@H]4C(N[C@@H](CCCCN)C(NCC(N)=O)=O)=O.CC(O)=O.CC(O)=O |
| Purity: | 99.76 |
| Description: | Terlipressin diacetate is a vasopressin analogue with potent vasoactive properties. Terlipressin diacetate is a highly selective vasopressin V1 receptor agonist that reduces the splanchnic blood flow and portal pressure and controls acute variceal bleeding. Terlipressin diacetate exerts anti-inflammatory and anti-oxidative effects. Terlipressin diacetate has the potential for hepatorenal syndrome and norepinephrine-resistant septic shock research[1][2][3][4][5]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
