5F-203 [CAS 260443-89-8]
Partner: MedChemexpress LLC
| CAS No: | 260443-89-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 258.31 |
| Formula: | C14H11FN2S |
| SMILES: | NC1=CC=C(C2=NC3=CC(F)=CC=C3S2)C=C1C |
| Purity: | 99.04 |
| Description: | 5F-203 (NSC-703786) is a cytotoxic molecule that forms DNA adducts and cell cycle arrest. 5F-203 induces aryl hydrocarbon receptor (AhR) signaling and elevates expression of CYP1A1. 5F-203 also increases the levels of reactive oxygen species as well as activates JNK, ERK, and p38[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
