BT-13 [CAS 924537-98-4]
Partner: MedChemexpress LLC
| CAS No: | 924537-98-4 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 517.54 |
| Formula: | C23H27F4N3O4S |
| SMILES: | O=S(C1=CC=C(OC)C(N2CCN(C(C3=CC=C(F)C=C3C(F)(F)F)=O)CC2)=C1)(N(CC)CC)=O |
| Purity: | 99.59 |
| Description: | BT-13 is a potent and selective glial cell line-derived neurotrophic factor (GDNF) receptor RET agonist independently of GFLs, promoting neurite growth from sensory neurons in vitro and attenuates experimental neuropathy in the Rat[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
