MY10 [CAS 2204270-73-3] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 2204270-73-3 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 384.36 |
| Formula: | C15H10F6OS2 |
| SMILES: | FC(SC1=CC=C(C=C1)COC2=CC=C(SC(F)(F)F)C=C2)(F)F |
| Purity: | 99.87 |
| Description: | MY10 is a potent and orally active receptor protein tyrosine phosphatase (RPTP?/?) inhibitor. MY10 attenuates binge-like ethanol consumption and ethanol reward[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
