RBC10 [CAS 362503-73-9] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 362503-73-9 |
| Applications: | Cancer-Kinase/protease |
| MW: | 408.92 |
| Formula: | C24H25ClN2O2 |
| SMILES: | O=C1CCCC2=C1C(N(C3=CC=CC=C3N2)C(CCCC)=O)C4=CC=CC=C4Cl |
| Purity: | 98.0 |
| Description: | RBC10 is an anti-cancer agent. RBC10 inhibits the binding of Ral to its effector RALBP1. RBC10 also inhibits Ral-mediated cell spreading of murine embryonic fibroblasts and anchorage-independent growth of human cancer cell lines[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
