MS-1020 [CAS 1255516-86-9]
Partner: MedChemexpress LLC
| CAS No: | 1255516-86-9 |
| Applications: | Cancer-Kinase/protease |
| MW: | 346.38 |
| Formula: | C21H18N2O3 |
| SMILES: | O=C(C1=CC=C2C=CC=CC2=C1O)NCCC3=CNC4=C3C=C(O)C=C4 |
| Description: | MS-1020 is a potent and ATP-competitive JAK3 inhibitor. MS-1020 inhibits JAK3/STAT signaling and induces apoptosis. MS-1020 promotes cell death. MS-1020 decreases the expression of tyrosine phosphorylated STAT3 levels. MS-1020 has the potential for the research of cancers harboring aberrant JAK3 signaling[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
