(-)-Camphoric acid [CAS 560-09-8] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 560-09-8 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 200.23 |
| Formula: | C10H16O4 |
| SMILES: | O=C([C@]1(C)C(C)(C)[C@H](C(O)=O)CC1)O |
| Purity: | 98.0 |
| Description: | (-)-Camphoric acid is the less active enantiomer of Camphoric acid. Camphoric acid stimulates osteoblast differentiation and induces glutamate receptor expression. Camphoric acid also significantly induced the activation of NF-?B and AP-1[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
