Alizarin Red S (sodium) [CAS 130-22-3] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 130-22-3 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 342.26 |
| Formula: | C14H7NaO7S |
| SMILES: | O=S(C(C=C1C2=O)=C(O)C(O)=C1C(C3=C2C=CC=C3)=O)(O[Na])=O |
| Purity: | 95.0 |
| Description: | Alizarin Red S sodium (ARS sodium) is an anthraquinone dye that has been widely used to evaluate calcium deposits in cell culture[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
