17-Phenyl trinor prostaglandin F2Alpha methyl amide [CAS 155206-01-2]
Partner: MedChemexpress LLC
| CAS No: | 155206-01-2 |
| MW: | 401.54 |
| Formula: | C24H35NO4 |
| SMILES: | O[C@@H]1[C@@H]([C@H]([C@@H](C1)O)/C=C/[C@H](CCC2=CC=CC=C2)O)C/C=C\CCCC(NC)=O |
| Description: | 17-Phenyl trinor prostaglandin F2? methyl amide is a prostaglandin F 2? (PGF 2?) analog that competes with native PGF 2? for receptor binding[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
