(+)-Mepivacaine [CAS 24358-84-7]
Partner: MedChemexpress LLC
| CAS No: | 24358-84-7 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 246.35 |
| Formula: | C15H22N2O |
| SMILES: | O=C(NC1=C(C=CC=C1C)C)[C@H]2N(CCCC2)C |
| Purity: | 99.72 |
| Description: | (+)-Mepivacaine is a racemic isomer of Mepivacaine (HY-B0517), which has analgesic and vasoconstrictive activity. Mepivacaine is an amide type agent that temporarily causes local loss of consciousness. Mepivacaine binds to specific voltage-gated sodium channels on neuronal cell membranes, inhibiting sodium influx and membrane depolarization[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
