(R)-PF-06256142 [CAS 1609583-15-4]
Partner: MedChemexpress LLC
| CAS No: | 1609583-15-4 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 356.38 |
| Formula: | C21H16N4O2 |
| SMILES: | CC1=CC(OC2=C(C=CO3)C3=CC=N2)=CC=[C@]1[C@]4=C(C)N=CC5=NC=CN54.[R] |
| Purity: | 99.60 |
| Description: | (R)-PF-06256142 is the R enantiomer of PF-06256142 with low active. PF-06256142 is a potent and selective orthosteric D1 receptor agonist that can reduce receptor desensitization relative to dopamine and other catechol-containing agonists[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
