(Rac)-PF-06256142 [CAS 1609580-97-3]
Partner: MedChemexpress LLC
| CAS No: | 1609580-97-3 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 356.38 |
| Formula: | C21H16N4O2 |
| SMILES: | CC1=C(C2=C(C)N=CC3=NC=CN32)C=CC(OC4=C(C=CO5)C5=CC=N4)=C1 |
| Purity: | 99.31 |
| Description: | (Rac)-PF-06256142 is the less effective enantiomer of PF-06256142 (HY-119943). (Rac)-PF-06256142 is an agonist of D1 receptor, with an EC50 of 107 nM. (Rac)-PF-06256142 can be used for the research of schizophrenia and Parkinson's disease[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
