RU-301 [CAS 1110873-99-8]
Partner: MedChemexpress LLC
| CAS No: | 1110873-99-8 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 480.46 |
| Formula: | C21H19F3N4O4S |
| SMILES: | O=C(NCCNC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O)C2=CC=CC=C2SCC3=CC(C)=NO3 |
| Purity: | 99.44 |
| Description: | RU-301 is a pan TAM inhibitor that blocks Gas6-induced TAM activation and tumorigenicity. RU-301 significantly reduces nonalcoholic steatohepatitis (NASH) fibrosis, along with attenuates ERK activation and TGF?1 expression. RU-301 can be used in studies of cancer and nonalcoholic steatohepatitis[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
