MSN-50 [CAS 1592908-75-2]
Partner: MedChemexpress LLC
| CAS No: | 1592908-75-2 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 688.61 |
| Formula: | C36H38BrN3O6 |
| SMILES: | O=C(C1=CC=CC=C1)N[C@@H](CC2=CC=CC=C2)C(N(CC3=CC=C(C=C3)Br)C[C@H]4OC5=CC(OCOCCOC)=CC=C5[C@@H]4N)=O |
| Purity: | 98.40 |
| Description: | MSN-50 is a Bax and Bak oligomerization inhibitor. MSN-50 efficiently inhibits liposome permeabilization, prevents genotoxic cell death and promotes neuroprotection[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
