DA 3003-2 [CAS 383907-47-9]
Partner: MedChemexpress LLC
| CAS No: | 383907-47-9 |
| Applications: | Cancer-programmed cell death |
| MW: | 321.76 |
| Formula: | C15H16ClN3O3 |
| SMILES: | O=C(C1=C(C2=O)N=CC=C1)C(NCCN3CCOCC3)=C2Cl |
| Purity: | 99.66 |
| Description: | DA 3003-2 is a potent and selectively Cdc25 inhibitor. DA 3003-2 shows antiproliferative activity. DA 3003-2 induces cell cycle arrest at the G2/M phase and increases the expression of P-tyr15 Cdc2. DA 3003-2 has the potential for the research of prostate cancer[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
