(Rac)-MGV354 [CAS 1852495-86-3]
Partner: MedChemexpress LLC
| CAS No: | 1852495-86-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 575.70 |
| Formula: | C35H37N5O3 |
| SMILES: | O=C(C1=C(C)N(C2=NC(C3=CC=CC4=C3C(NC5=CC=C(C6CCN(C(C7CC7)=O)CC6)C=C5C)CC4)=CC=C2)N=C1)O |
| Purity: | 99.66 |
| Description: | (Rac)-MGV354 is the racemate of MGV354. MGV354 is a soluble guanylate cyclase (sGC) activator with EC50s of <0.5 nM, and 5 nM in CHO and GTM-3 E cells, respectively[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
