4-Hydroperoxy Cyclophosphamide-d4 [CAS 1246816-71-6]
Partner: MedChemexpress LLC
| CAS No: | 1246816-71-6 |
| Applications: | COVID-19-anti-virus |
| MW: | 297.11 |
| Formula: | C7H11D4Cl2N2O4P |
| SMILES: | N(CC(Cl)([2H])[2H])(CC(Cl)([2H])[2H])P1(=O)NC(OO)CCO1 |
| Purity: | 95.0 |
| Description: | 4-Hydroperoxy Cyclophosphamide-d4 is the deuterium labeled 4-Hydroperoxy cyclophosphamide. 4-Hydroperoxy cyclophosphamide is the active metabolite form of the proagent Cyclophosphamide. 4-Hydroperoxy cyclophosphamide crosslinks DNA and induces T cell apoptosis independent of death receptor activation, but activates mitochondrial death pathways through production of reactive oxygen species (ROS). 4-Hydroperoxy cyclophosphamide has the potential for lymphomas and autoimmune disorders[1][2]. |
| Shipping Conditions: | Ship on dry ice |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
