ALLO-2 [CAS 1357350-60-7]
Partner: MedChemexpress LLC
| CAS No: | 1357350-60-7 |
| Applications: | Cancer-programmed cell death |
| MW: | 371.32 |
| Formula: | C18H12F3N5O |
| SMILES: | FC(F)(OC1=CC=C(C=C1)C2=NC(NC3=CC4=C(C=C3)NN=C4)=NC=C2)F |
| Purity: | 99.72 |
| Description: | ALLO-2 is a potent drug-resistant Smoothened (Smo) mutant antagonist that inhibits Smo agonist Hh-Ag1.5-induced luciferase expression in TM3-Gli-Luc cells with IC50 of 6 nM[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
