4-Methylumbelliferyl oleate [CAS 18323-58-5]
Partner: MedChemexpress LLC
| CAS No: | 18323-58-5 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 440.61 |
| Formula: | C28H40O4 |
| SMILES: | O=C1C=C(C2=C(O1)C=C(C=C2)OC(CCCCCCC/C=C\CCCCCCCC)=O)C |
| Purity: | 99.68 |
| Description: | 4-Methylumbelliferyl oleate is a fluorogenic substrate for acid and alkaline lipases. 4-Methylumbelliferyl oleate is cleaved by lipases, liberating 4-Methylumbelliferyl (Ex/Em=320/450 nm)[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
