Anecortave acetate [CAS 7753-60-8]
Partner: MedChemexpress LLC
| CAS No: | 7753-60-8 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 386.48 |
| Formula: | C23H30O5 |
| SMILES: | C[C@@]12[C@](O)(CC[C@]1([C@@]3(CCC4=CC(CC[C@@]4(C3=CC2)C)=O)[H])[H])C(COC(C)=O)=O |
| Purity: | 99.0 |
| Description: | Anecortave acetate is a potent ocular angiostatic agent. Anecortave acetate inhibits neovascularization which is induced by many different angiogenic factors, and increases plasminogen activator inhibitor-1 (PAI-1) mRNA expression. Anecortave acetate can be used to research ocular neovascular diseases[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
