MS15203 [CAS 73912-52-4]
Partner: MedChemexpress LLC
| CAS No: | 73912-52-4 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 249.22 |
| Formula: | C12H11NO5 |
| SMILES: | CC(C(NC1=CC(C(O)=O)=CC(C(O)=O)=C1)=O)=C |
| Purity: | 99.51 |
| Description: | MS15203 is a potent and selective GPR171 agonist. MS15203 increases food intake and body weight. MS15203 increases neuronal activity. MS15203 significantly increases the abundance of the mRNAs encoding proSAAS, NPY, AgRP[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
