Bim-IN-1 [CAS 2909483-36-7]
Partner: MedChemexpress LLC
| CAS No: | 2909483-36-7 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 416.34 |
| Formula: | C19H20Cl2FNO2S |
| SMILES: | FC1=CC(C2N(S(=O)(CC3=CC=C(Cl)C=C3Cl)=O)CCCCC2)=CC=C1 |
| Purity: | 99.57 |
| Description: | Bim-IN-1 is a potent Bim expression inhibitor. Bim-IN-1 reduces Bim expression levels and has little inhibitory effect upon protein kinase A activity and minimal toxicity[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
