(S)-TXNIP-IN-1 [CAS 1212421-96-9]
Partner: MedChemexpress LLC
| CAS No: | 1212421-96-9 |
| MW: | 248.23 |
| Formula: | C12H12N2O4 |
| SMILES: | O=C(O)[C@H](C(C)C)N(C1=O)C(C2=C1C=CN=C2)=O |
| Purity: | 99.73 |
| Description: | (S)-TXNIP-IN-1 is the less active S-enantiomer of TXNIP-IN-1 (HY-115688). TXNIP-IN-1 is a TXNIP-TRX complex inhibitor which can be used in the research of TXNIP-TRX complex associated metabolic disorder (diabetes), cardiovascular disease, or inflammatory disease[1] |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
