DBCO-NHS ester 2 [CAS 1384870-47-6]
Partner: MedChemexpress LLC
| CAS No: | 1384870-47-6 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 430.45 |
| Formula: | C25H22N2O5 |
| SMILES: | O=C1CCC(N1OC(CCCCC(N2C3=CC=CC=C3C#CC(C=CC=C4)=C4C2)=O)=O)=O |
| Purity: | 98.0 |
| Description: | DBCO-NHS ester 2 is a cleavable linker that is used for making antibody-drug conjugate (ADC). DBCO-NHS ester 2 is a derivative of Dibenzylcyclooctyne (DBCO) used in copper-free click chemistry[1]. DBCO-NHS ester 2 is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
