(E/Z)-GO289 [CAS 694522-87-7]
Partner: MedChemexpress LLC
| CAS No: | 694522-87-7 |
| Applications: | Cancer-Kinase/protease |
| MW: | 419.30 |
| Formula: | C17H15BrN4O2S |
| SMILES: | OC1=CC(Br)=C(/C=N/N2C(SC)=NN=C2C3=CC=CC=C3)C=C1OC |
| Purity: | 99.72 |
| Description: | (E/Z)-GO289 is a potent and selective casein kinase 2 (CK2) inhibitor (IC50=7 nM). (E/Z)-GO289 strongly lengthens circadian period. (E/Z)-GO289 exhibits cell type�dependent inhibition of cancer cell growth that correlated with cellular clock function[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
