DPQ [CAS 129075-73-6]
Partner: MedChemexpress LLC
| CAS No: | 129075-73-6 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 302.41 |
| Formula: | C18H26N2O2 |
| SMILES: | O=C1C2=C(CCN1)C(OCCCCN3CCCCC3)=CC=C2 |
| Purity: | 99.0 |
| Description: | DPQ is a potent PARP-1 inhibitor. DPQ can reduce the N-methyl-d-aspartate (NMDA)-induced PARP activation, restoring ATP to near control levels and significantly attenuating neuronal injury in the severe NMDA exposure model. DPQ can be used for researching neuroprotection[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
