MS-PPOH [CAS 206052-02-0]
Partner: MedChemexpress LLC
| CAS No: | 206052-02-0 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 323.41 |
| Formula: | C16H21NO4S |
| SMILES: | O=C(NS(=O)(C)=O)CCCCCC1=CC=CC=C1OCC#C |
| Purity: | 99.27 |
| Description: | MS-PPOH is a potent and selective cytochrome P450 (CYP) epoxygenase inhibitor[1]. MS-PPOH inhibits CYP2C8 and CYP2C9 with IC50s of 15 and 11 μM, respectively[2]. MS-PPOH is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
