(Rac)-Tenofovir-d6 [CAS 1020719-94-1]
Partner: MedChemexpress LLC
| CAS No: | 1020719-94-1 |
| Applications: | COVID-19-anti-virus |
| MW: | 293.25 |
| Formula: | C9H8D6N5O4P |
| SMILES: | OP(O)(COC(C([2H])([2H])N1C=NC2=C(N)N=CN=C12)([2H])C([2H])([2H])[2H])=O |
| Purity: | 98.98 |
| Description: | (Rac)-Tenofovir-d6 is a labelled racemic Tenofovir. Tenofovir (GS 1278) is a nucleotide reverse transcriptase inhibitor to treat HIV and chronic Hepatitis B (HBV)[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
