Gamma-glutamylcysteine [CAS 636-58-8]
Partner: MedChemexpress LLC
| CAS No: | 636-58-8 |
| Applications: | COVID-19-anti-virus |
| MW: | 250.27 |
| Formula: | C8H14N2O5S |
| SMILES: | SC[C@@H](C(O)=O)NC(CC[C@H](N)C(O)=O)=O |
| Purity: | 95.42 |
| Description: | Gamma-glutamylcysteine (?-Glutamylcysteine), a dipeptide containing cysteine and glutamic acid, is a precursor to glutathione (GSH). Gamma-glutamylcysteine is a cofactor for glutathione peroxidase (GPx) to increase GSH levels[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
