(3-Carboxypropyl)trimethylammonium chloride [CAS 6249-56-5] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 6249-56-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 181.66 |
| Formula: | C7H16ClNO2 |
| SMILES: | C[N+](C)(C)CCCC(O)=O.[Cl-] |
| Purity: | 98.0 |
| Description: | (3-Carboxypropyl)trimethylammonium chloride is angiopathic substance produced as an intermediary metabolite by gut microbiota that feed on carnitine in dietary red meat. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
