3-Nitro-L-tyrosine-d3 [CAS 213386-10-8]
Partner: MedChemexpress LLC
| CAS No: | 213386-10-8 |
| MW: | 229.20 |
| Formula: | C9H7D3N2O5 |
| SMILES: | N[C@@H](CC1=C([2H])C([N+]([O-])=O)=C(O)C([2H])=C1[2H])C(O)=O |
| Purity: | 99.0 |
| Description: | 3-Nitro-L-tyrosine-d3 is the deuterium labeled 3-Nitro-L-tyrosine. 3-Nitro-L-tyrosine is a biomarker of nitrogen free radical species modified proteins in systemic autoimmunogenic conditions[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
