15-keto-Prostaglandin F2a [CAS 35850-13-6]
Partner: MedChemexpress LLC
| CAS No: | 35850-13-6 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 352.47 |
| Formula: | C20H32O5 |
| SMILES: | CCCCCC(/C=C/[C@@H]1[C@H]([C@@H](O)C[C@H]1O)C/C=C\CCCC(O)=O)=O |
| Description: | 15-keto-Prostaglandin F2? (15-keto-PGF2?) is a metabolite of Prostaglandin F2?. Prostaglandin F2?. Prostaglandin F2? is an orally active, potent prostaglandin F (PGF) receptor (FP receptor) agonist and plays a key role in the onset and progression of labour[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
